C23H40OSi2 — CID 101063553
2,4-dibutyl-3,5-bis[dimethyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one (PubChem CID 101063553) has the molecular formula C23H40OSi2 and a molecular weight of 388.74 g/mol. Its IUPAC name is 2,4-dibutyl-3,5-bis[dimethyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 2,4-dibutyl-3,5-bis[dimethyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 101063553 |
| Molecular Formula | C23H40OSi2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2,4-dibutyl-3,5-bis[dimethyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C)(C)C1=C(CCCC)C([Si](C)(C)CC=C)=C(CCCC)C1=O |
| InChI | InChI=1S/C23H40OSi2/c1-9-13-15-19-21(24)23(26(7,8)18-12-4)20(16-14-10-2)22(19)25(5,6)17-11-3/h11-12H,3-4,9-10,13-18H2,1-2,5-8H3 |
| InChIKey | KALRUZITJWPRHW-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|