C28H31N3O8S2 — CID 101068314
4-[[9-amino-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 101068314) has the molecular formula C28H31N3O8S2 and a molecular weight of 601.70 g/mol. Its IUPAC name is 4-[[9-amino-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[[9-amino-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 101068314 |
| Molecular Formula | C28H31N3O8S2 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | 4-[[9-amino-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCC(=O)O)C(=O)C2(N)c3ccccc3N(CCCS(=O)(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O8S2/c1-20-13-15-21(16-14-20)41(38,39)31(18-6-12-26(32)33)27(34)28(29)22-8-2-4-10-24(22)30(17-7-19-40(35,36)37)25-11-5-3-9-23(25)28/h2-5,8-11,13-16H,6-7,12,17-19,29H2,1H3,(H,32,33)(H,35,36,37) |
| InChIKey | SOUVOVFIIHMWQD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 175.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|