C28H31N3O9S2 — CID 101068326
4-[[9-(hydroxyamino)-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 101068326) has the molecular formula C28H31N3O9S2 and a molecular weight of 617.70 g/mol. Its IUPAC name is 4-[[9-(hydroxyamino)-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[[9-(hydroxyamino)-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 101068326 |
| Molecular Formula | C28H31N3O9S2 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 4-[[9-(hydroxyamino)-10-(3-sulfopropyl)acridine-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCC(=O)O)C(=O)C2(NO)c3ccccc3N(CCCS(=O)(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O9S2/c1-20-13-15-21(16-14-20)42(39,40)31(18-6-12-26(32)33)27(34)28(29-35)22-8-2-4-10-24(22)30(17-7-19-41(36,37)38)25-11-5-3-9-23(25)28/h2-5,8-11,13-16,29,35H,6-7,12,17-19H2,1H3,(H,32,33)(H,36,37,38) |
| InChIKey | ZAPGOZTZQLSIBZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|