C15H20NO2+ — CID 101075133
ethyl 2,6,7-trimethyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate (PubChem CID 101075133) has the molecular formula C15H20NO2+ and a molecular weight of 246.33 g/mol. Its IUPAC name is ethyl 2,6,7-trimethyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate.
| Compound Name | ethyl 2,6,7-trimethyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate |
|---|---|
| PubChem CID | 101075133 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | ethyl 2,6,7-trimethyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate |
| SMILES | CCOC(=O)C1=[N+](C)CCc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C15H20NO2/c1-5-18-15(17)14-13-9-11(3)10(2)8-12(13)6-7-16(14)4/h8-9H,5-7H2,1-4H3/q+1 |
| InChIKey | UFKLBHDKMGSKOI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|