C6H12NO2- — CID 101079856
2-amino-2,3,3-trideuterio-4-methylpentanoate (PubChem CID 101079856) has the molecular formula C6H12NO2- and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-amino-2,3,3-trideuterio-4-methylpentanoate.
| Compound Name | 2-amino-2,3,3-trideuterio-4-methylpentanoate |
|---|---|
| PubChem CID | 101079856 |
| Molecular Formula | C6H12NO2- |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-amino-2,3,3-trideuterio-4-methylpentanoate |
| SMILES | [2H]C(N)(C(=O)[O-])C([2H])([2H])C(C)C |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/p-1/i3D2,5D |
| InChIKey | ROHFNLRQFUQHCH-MSYDVTBWSA-M |
| XLogP | -0.89 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |