C60H74GeS6 — CID 101081088
7-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-7-[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]hexathiagermepane (PubChem CID 101081088) has the molecular formula C60H74GeS6 and a molecular weight of 1060.26 g/mol. Its IUPAC name is 7-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-7-[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]hexathiagermepane.
| Compound Name | 7-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-7-[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]hexathiagermepane |
|---|---|
| PubChem CID | 101081088 |
| Molecular Formula | C60H74GeS6 |
| Molecular Weight | 1060.26 g/mol |
| Exact Mass | 1060.33 |
| IUPAC Name | 7-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-7-[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]hexathiagermepane |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Ge]2(c3c(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cccc3-c3c(C(C)C)cc(C(C)C)cc3C(C)C)SSSSSS2)c(C)c1 |
| InChI | InChI=1S/C60H74GeS6/c1-33(2)45-29-51(35(5)6)57(52(30-45)36(7)8)49-23-20-24-50(58-53(37(9)10)31-46(34(3)4)32-54(58)38(11)12)60(49)61(62-64-66-67-65-63-61)59-47(55-41(15)25-39(13)26-42(55)16)21-19-22-48(59)56-43(17)27-40(14)28-44(56)18/h19-38H,1-18H3 |
| InChIKey | RSXXICJBHAWSAX-UHFFFAOYSA-N |
| XLogP | 20.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.26 |
| LogP ≤ 5 | 20.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|