C32H49P — CID 58067321
2,2,8,8-tetramethyl-1-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphocane (PubChem CID 58067321) has the molecular formula C32H49P and a molecular weight of 464.72 g/mol. Its IUPAC name is 2,2,8,8-tetramethyl-1-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphocane.
| Compound Name | 2,2,8,8-tetramethyl-1-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphocane |
|---|---|
| PubChem CID | 58067321 |
| Molecular Formula | C32H49P |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.36 |
| IUPAC Name | 2,2,8,8-tetramethyl-1-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphocane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccccc2P2C(C)(C)CCCCCC2(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C32H49P/c1-22(2)25-20-27(23(3)4)30(28(21-25)24(5)6)26-16-12-13-17-29(26)33-31(7,8)18-14-11-15-19-32(33,9)10/h12-13,16-17,20-24H,11,14-15,18-19H2,1-10H3 |
| InChIKey | HBWLLFOZCKHUTA-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|