C36H54 — CID 177211628
2-[2-(1,1-dicyclohexylpropyl)phenyl]-1,3,5-tri(propan-2-yl)benzene (PubChem CID 177211628) has the molecular formula C36H54 and a molecular weight of 486.83 g/mol. Its IUPAC name is 2-[2-(1,1-dicyclohexylpropyl)phenyl]-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[2-(1,1-dicyclohexylpropyl)phenyl]-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 177211628 |
| Molecular Formula | C36H54 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.42 |
| IUPAC Name | 2-[2-(1,1-dicyclohexylpropyl)phenyl]-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CCC(c1ccccc1-c1c(C(C)C)cc(C(C)C)cc1C(C)C)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C36H54/c1-8-36(29-17-11-9-12-18-29,30-19-13-10-14-20-30)34-22-16-15-21-31(34)35-32(26(4)5)23-28(25(2)3)24-33(35)27(6)7/h15-16,21-27,29-30H,8-14,17-20H2,1-7H3 |
| InChIKey | UNVAPJVTVOKUCE-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |