About CID 15486274
CID 15486274 (PubChem CID 15486274) has the molecular formula C39H48Ge
and a molecular weight of 589.42 g/mol.
Molecular Properties
| Compound Name | CID 15486274 |
| PubChem CID | 15486274 |
| Molecular Formula | C39H48Ge |
| Molecular Weight | 589.42 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Ge]c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C)c1 |
| InChI | InChI=1S/C39H48Ge/c1-22(2)31-20-34(23(3)4)39(35(21-31)24(5)6)40-38-32(36-27(9)16-25(7)17-28(36)10)14-13-15-33(38)37-29(11)18-26(8)19-30(37)12/h13-24H,1-12H3 |
| InChIKey | SPCHESLTVJWTHS-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.42 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 15486274 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15486274?
The IUPAC name of CID 15486274 (CID 15486274) is not available.
What is the SMILES notation for CID 15486274?
The canonical SMILES for CID 15486274 is Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Ge]c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C)c1.
What is the InChIKey of CID 15486274?
The InChIKey is SPCHESLTVJWTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H48Ge/c1-22(2)31-20-34(23(3)4)39(35(21-31)24(5)6)40-38-32(36-27(9)16-25(7)17-28(36)10)14-13-15-33(38)37-29(11)18-26(8)19-30(37)12/h13-24H,1-12H3.
What are the key properties of CID 15486274?
CID 15486274 has a molecular weight of 589.42 g/mol, XLogP of 9.90, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15486274 is sourced from PubChem (CID 15486274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).