C28H33NO7 — CID 101081568
ethyl (3R,6S,7S,7aS)-6-(4-methoxyphenyl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 101081568) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is ethyl (3R,6S,7S,7aS)-6-(4-methoxyphenyl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6S,7S,7aS)-6-(4-methoxyphenyl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 101081568 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | ethyl (3R,6S,7S,7aS)-6-(4-methoxyphenyl)-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2ccc(OC)cc2)C(=O)N2[C@@H](c3ccccc3)OC[C@@H]2[C@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33NO7/c1-6-34-26(32)28(19-12-14-20(33-5)15-13-19)21(16-23(30)36-27(2,3)4)22-17-35-24(29(22)25(28)31)18-10-8-7-9-11-18/h7-15,21-22,24H,6,16-17H2,1-5H3/t21-,22-,24-,28-/m1/s1 |
| InChIKey | VZPQKZXRYYTTSZ-XABBOIKWSA-N |
| XLogP | 3.78 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|