C17H29N3O2S3 — CID 101082759
[(4-methylphenyl)sulfonylamino] 2,2-bis(diethylamino)ethanedithioate (PubChem CID 101082759) has the molecular formula C17H29N3O2S3 and a molecular weight of 403.64 g/mol. Its IUPAC name is [(4-methylphenyl)sulfonylamino] 2,2-bis(diethylamino)ethanedithioate.
| Compound Name | [(4-methylphenyl)sulfonylamino] 2,2-bis(diethylamino)ethanedithioate |
|---|---|
| PubChem CID | 101082759 |
| Molecular Formula | C17H29N3O2S3 |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(4-methylphenyl)sulfonylamino] 2,2-bis(diethylamino)ethanedithioate |
| SMILES | CCN(CC)C(C(=S)SNS(=O)(=O)c1ccc(C)cc1)N(CC)CC |
| InChI | InChI=1S/C17H29N3O2S3/c1-6-19(7-2)16(20(8-3)9-4)17(23)24-18-25(21,22)15-12-10-14(5)11-13-15/h10-13,16,18H,6-9H2,1-5H3 |
| InChIKey | PAQHIFYQCPEUDB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|