C26H32N2O4Si — CID 101084726
2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-[(1R)-1-phenylmethoxyethyl]azetidin-3-yl]isoindole-1,3-dione (PubChem CID 101084726) has the molecular formula C26H32N2O4Si and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-[(1R)-1-phenylmethoxyethyl]azetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-[(1R)-1-phenylmethoxyethyl]azetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101084726 |
| Molecular Formula | C26H32N2O4Si |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-[(1R)-1-phenylmethoxyethyl]azetidin-3-yl]isoindole-1,3-dione |
| SMILES | C[C@@H](OCc1ccccc1)[C@H]1[C@H](N2C(=O)c3ccccc3C2=O)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H32N2O4Si/c1-17(32-16-18-12-8-7-9-13-18)21-22(25(31)28(21)33(5,6)26(2,3)4)27-23(29)19-14-10-11-15-20(19)24(27)30/h7-15,17,21-22H,16H2,1-6H3/t17-,21+,22+/m1/s1 |
| InChIKey | BXJUCALPUOBTSB-WTNAPCKOSA-N |
| XLogP | 4.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|