About methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate
methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate (PubChem CID 101086562) has the molecular formula C20H20O7
and a molecular weight of 372.37 g/mol. Its IUPAC name is methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate |
| PubChem CID | 101086562 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate |
| SMILES | COC(=O)C1(c2c(OC)cc(OC)cc2OC)C(=O)COc2ccccc21 |
| InChI | InChI=1S/C20H20O7/c1-23-12-9-15(24-2)18(16(10-12)25-3)20(19(22)26-4)13-7-5-6-8-14(13)27-11-17(20)21/h5-10H,11H2,1-4H3 |
| InChIKey | TYPIZZRULGLJID-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate?
The IUPAC name of methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate (CID 101086562) is methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate.
What is the SMILES notation for methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate?
The canonical SMILES for methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate is COC(=O)C1(c2c(OC)cc(OC)cc2OC)C(=O)COc2ccccc21.
What is the InChIKey of methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate?
The InChIKey is TYPIZZRULGLJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O7/c1-23-12-9-15(24-2)18(16(10-12)25-3)20(19(22)26-4)13-7-5-6-8-14(13)27-11-17(20)21/h5-10H,11H2,1-4H3.
What are the key properties of methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate?
methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate has a molecular weight of 372.37 g/mol, XLogP of 2.13, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-4-(2,4,6-trimethoxyphenyl)chromene-4-carboxylate is sourced from PubChem (CID 101086562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).