C14H23IOSi — CID 101089142
cis-(2S,3R)-2-iodo-3-methyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexan-1-one (PubChem CID 101089142) has the molecular formula C14H23IOSi and a molecular weight of 362.33 g/mol. Its IUPAC name is cis-(2S,3R)-2-iodo-3-methyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexan-1-one.
| Compound Name | cis-(2S,3R)-2-iodo-3-methyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 101089142 |
| Molecular Formula | C14H23IOSi |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | cis-(2S,3R)-2-iodo-3-methyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexan-1-one |
| SMILES | C[C@]1(CCC#C[Si](C)(C)C)CCCC(=O)[C@H]1I |
| InChI | InChI=1S/C14H23IOSi/c1-14(9-5-6-11-17(2,3)4)10-7-8-12(16)13(14)15/h13H,5,7-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | MFOJGDGFGCXRAN-KGLIPLIRSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|