C15H12 — CID 101091328
9-(2,2,2-trideuterioethylidene)fluorene (PubChem CID 101091328) has the molecular formula C15H12 and a molecular weight of 195.28 g/mol. Its IUPAC name is 9-(2,2,2-trideuterioethylidene)fluorene.
| Compound Name | 9-(2,2,2-trideuterioethylidene)fluorene |
|---|---|
| PubChem CID | 101091328 |
| Molecular Formula | C15H12 |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 9-(2,2,2-trideuterioethylidene)fluorene |
| SMILES | [2H]C([2H])([2H])C=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H12/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15/h2-10H,1H3/i1D3 |
| InChIKey | OFOJRCNUMYVCSD-FIBGUPNXSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |