C15H28NO5P — CID 101092521
6-diethoxyphosphoryl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)hexan-2-one (PubChem CID 101092521) has the molecular formula C15H28NO5P and a molecular weight of 333.37 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)hexan-2-one.
| Compound Name | 6-diethoxyphosphoryl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)hexan-2-one |
|---|---|
| PubChem CID | 101092521 |
| Molecular Formula | C15H28NO5P |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6-diethoxyphosphoryl-6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)hexan-2-one |
| SMILES | CCOP(=O)(OCC)C(CCCC(C)=O)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C15H28NO5P/c1-6-20-22(18,21-7-2)13(10-8-9-12(3)17)14-16-15(4,5)11-19-14/h13H,6-11H2,1-5H3 |
| InChIKey | GGYNROZEPMLGHB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|