C15H15NS — CID 101093445
1-(3-phenyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-4-yl)ethanethiol (PubChem CID 101093445) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-(3-phenyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-4-yl)ethanethiol.
| Compound Name | 1-(3-phenyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-4-yl)ethanethiol |
|---|---|
| PubChem CID | 101093445 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(3-phenyl-2-azabicyclo[4.2.0]octa-1,3,5-trien-4-yl)ethanethiol |
| SMILES | CC(S)c1cc2c(nc1-c1ccccc1)CC2 |
| InChI | InChI=1S/C15H15NS/c1-10(17)13-9-12-7-8-14(12)16-15(13)11-5-3-2-4-6-11/h2-6,9-10,17H,7-8H2,1H3 |
| InChIKey | AYNDONRMDQOFJD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|