C21H27NO3 — CID 101093638
methyl (4aS)-1-benzyl-4,4a,8-trimethyl-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 101093638) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl (4aS)-1-benzyl-4,4a,8-trimethyl-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | methyl (4aS)-1-benzyl-4,4a,8-trimethyl-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 101093638 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (4aS)-1-benzyl-4,4a,8-trimethyl-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1C(=O)N(Cc2ccccc2)C2=C(C)CCC[C@@]2(C)C1C |
| InChI | InChI=1S/C21H27NO3/c1-14-9-8-12-21(3)15(2)17(20(24)25-4)19(23)22(18(14)21)13-16-10-6-5-7-11-16/h5-7,10-11,15,17H,8-9,12-13H2,1-4H3/t15?,17?,21-/m0/s1 |
| InChIKey | JMKQNDRORVBMOW-GRXDXKALSA-N |
| XLogP | 3.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|