C19H18O3S3 — CID 101095190
4-(benzenesulfonyl)-1-[5-(5-methylthiophen-2-yl)thiophen-2-yl]butan-1-one (PubChem CID 101095190) has the molecular formula C19H18O3S3 and a molecular weight of 390.55 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-[5-(5-methylthiophen-2-yl)thiophen-2-yl]butan-1-one.
| Compound Name | 4-(benzenesulfonyl)-1-[5-(5-methylthiophen-2-yl)thiophen-2-yl]butan-1-one |
|---|---|
| PubChem CID | 101095190 |
| Molecular Formula | C19H18O3S3 |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 4-(benzenesulfonyl)-1-[5-(5-methylthiophen-2-yl)thiophen-2-yl]butan-1-one |
| SMILES | Cc1ccc(-c2ccc(C(=O)CCCS(=O)(=O)c3ccccc3)s2)s1 |
| InChI | InChI=1S/C19H18O3S3/c1-14-9-10-18(23-14)19-12-11-17(24-19)16(20)8-5-13-25(21,22)15-6-3-2-4-7-15/h2-4,6-7,9-12H,5,8,13H2,1H3 |
| InChIKey | DYSMBCOMAFBFIB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |