C17H24O7 — CID 101096001
[(1S,2R,3S,6R,9R)-3-acetyloxy-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methyl acetate (PubChem CID 101096001) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is [(1S,2R,3S,6R,9R)-3-acetyloxy-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methyl acetate.
| Compound Name | [(1S,2R,3S,6R,9R)-3-acetyloxy-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methyl acetate |
|---|---|
| PubChem CID | 101096001 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(1S,2R,3S,6R,9R)-3-acetyloxy-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H](OC(C)=O)[C@@H]2[C@@H]3OC(C)(C)OC[C@H]3OC[C@@H]12 |
| InChI | InChI=1S/C17H24O7/c1-9(18)20-6-11-5-13(23-10(2)19)15-12(11)7-21-14-8-22-17(3,4)24-16(14)15/h5,12-16H,6-8H2,1-4H3/t12-,13-,14+,15+,16+/m0/s1 |
| InChIKey | MELOEHYQXQLZDR-AALSBFMBSA-N |
| XLogP | 1.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|