C14H20O3 — CID 101096330
[(1R,5S,6S)-1-methyl-10-oxospiro[5.5]undec-8-en-5-yl] acetate (PubChem CID 101096330) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is [(1R,5S,6S)-1-methyl-10-oxospiro[5.5]undec-8-en-5-yl] acetate.
| Compound Name | [(1R,5S,6S)-1-methyl-10-oxospiro[5.5]undec-8-en-5-yl] acetate |
|---|---|
| PubChem CID | 101096330 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [(1R,5S,6S)-1-methyl-10-oxospiro[5.5]undec-8-en-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@@H](C)[C@@]12CC=CC(=O)C2 |
| InChI | InChI=1S/C14H20O3/c1-10-5-3-7-13(17-11(2)15)14(10)8-4-6-12(16)9-14/h4,6,10,13H,3,5,7-9H2,1-2H3/t10-,13+,14+/m1/s1 |
| InChIKey | ORIDNGNTBHGWDF-SWHYSGLUSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |