C19H22O5 — CID 101097100
(3S,8aR)-8a-hydroxy-3,6,6,8,8-pentamethyl-3-phenyl-1,2-benzodioxine-5,7-dione (PubChem CID 101097100) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (3S,8aR)-8a-hydroxy-3,6,6,8,8-pentamethyl-3-phenyl-1,2-benzodioxine-5,7-dione.
| Compound Name | (3S,8aR)-8a-hydroxy-3,6,6,8,8-pentamethyl-3-phenyl-1,2-benzodioxine-5,7-dione |
|---|---|
| PubChem CID | 101097100 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (3S,8aR)-8a-hydroxy-3,6,6,8,8-pentamethyl-3-phenyl-1,2-benzodioxine-5,7-dione |
| SMILES | CC1(C)C(=O)C2=C[C@@](C)(c3ccccc3)OO[C@]2(O)C(C)(C)C1=O |
| InChI | InChI=1S/C19H22O5/c1-16(2)14(20)13-11-18(5,12-9-7-6-8-10-12)23-24-19(13,22)17(3,4)15(16)21/h6-11,22H,1-5H3/t18-,19-/m0/s1 |
| InChIKey | NMNAWIWMTYDJOK-OALUTQOASA-N |
| XLogP | 2.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|