C32H42O6Si — CID 23630731
(3S,8aS)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8a-methoxy-3,6,6,8,8-pentamethyl-1,2-benzodioxine-5,7-dione (PubChem CID 23630731) has the molecular formula C32H42O6Si and a molecular weight of 550.77 g/mol. Its IUPAC name is (3S,8aS)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8a-methoxy-3,6,6,8,8-pentamethyl-1,2-benzodioxine-5,7-dione.
| Compound Name | (3S,8aS)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8a-methoxy-3,6,6,8,8-pentamethyl-1,2-benzodioxine-5,7-dione |
|---|---|
| PubChem CID | 23630731 |
| Molecular Formula | C32H42O6Si |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | (3S,8aS)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8a-methoxy-3,6,6,8,8-pentamethyl-1,2-benzodioxine-5,7-dione |
| SMILES | CO[C@@]12OO[C@@](C)(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=C1C(=O)C(C)(C)C(=O)C2(C)C |
| InChI | InChI=1S/C32H42O6Si/c1-28(2,3)39(23-16-12-10-13-17-23,24-18-14-11-15-19-24)36-21-20-31(8)22-25-26(33)29(4,5)27(34)30(6,7)32(25,35-9)38-37-31/h10-19,22H,20-21H2,1-9H3/t31-,32+/m0/s1 |
| InChIKey | QWRITLMKSVKCRI-AJQTZOPKSA-N |
| XLogP | 5.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|