C34H41BrO3Si2 — CID 25260245
2-bromo-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(4-methoxyphenyl)-6-trimethylsilylcyclohexa-2,5-dien-1-one (PubChem CID 25260245) has the molecular formula C34H41BrO3Si2 and a molecular weight of 633.78 g/mol. Its IUPAC name is 2-bromo-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(4-methoxyphenyl)-6-trimethylsilylcyclohexa-2,5-dien-1-one.
| Compound Name | 2-bromo-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(4-methoxyphenyl)-6-trimethylsilylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 25260245 |
| Molecular Formula | C34H41BrO3Si2 |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | 2-bromo-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(4-methoxyphenyl)-6-trimethylsilylcyclohexa-2,5-dien-1-one |
| SMILES | COc1ccc(C2(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=C(Br)C(=O)C([Si](C)(C)C)=C2)cc1 |
| InChI | InChI=1S/C34H41BrO3Si2/c1-33(2,3)40(28-14-10-8-11-15-28,29-16-12-9-13-17-29)38-23-22-34(26-18-20-27(37-4)21-19-26)24-30(35)32(36)31(25-34)39(5,6)7/h8-21,24-25H,22-23H2,1-7H3 |
| InChIKey | WUAMTXRHEXRVJG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|