C12H11NO2 — CID 101097261
(1aS,7bS)-1a,7b-dimethyl-2H-oxireno[2,3-c]chromene-6-carbonitrile (PubChem CID 101097261) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is (1aS,7bS)-1a,7b-dimethyl-2H-oxireno[2,3-c]chromene-6-carbonitrile.
| Compound Name | (1aS,7bS)-1a,7b-dimethyl-2H-oxireno[2,3-c]chromene-6-carbonitrile |
|---|---|
| PubChem CID | 101097261 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (1aS,7bS)-1a,7b-dimethyl-2H-oxireno[2,3-c]chromene-6-carbonitrile |
| SMILES | C[C@@]12O[C@@]1(C)COc1ccc(C#N)cc12 |
| InChI | InChI=1S/C12H11NO2/c1-11-7-14-10-4-3-8(6-13)5-9(10)12(11,2)15-11/h3-5H,7H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | CQNGHBYUZPKSQQ-RYUDHWBXSA-N |
| XLogP | 1.95 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|