C25H36NO7P — CID 101099052
N-benzyl-N-[(S)-diethoxyphosphoryl-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl]hydroxylamine (PubChem CID 101099052) has the molecular formula C25H36NO7P and a molecular weight of 493.54 g/mol. Its IUPAC name is N-benzyl-N-[(S)-diethoxyphosphoryl-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl]hydroxylamine.
| Compound Name | N-benzyl-N-[(S)-diethoxyphosphoryl-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 101099052 |
| Molecular Formula | C25H36NO7P |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-benzyl-N-[(S)-diethoxyphosphoryl-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl]hydroxylamine |
| SMILES | CCOP(=O)(OCC)[C@@H]([C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C25H36NO7P/c1-5-30-34(28,31-6-2)24(26(27)17-20-13-9-7-10-14-20)23-22(32-25(3,4)33-23)19-29-18-21-15-11-8-12-16-21/h7-16,22-24,27H,5-6,17-19H2,1-4H3/t22-,23+,24-/m0/s1 |
| InChIKey | PUIAJRQRFOCKSW-VXNXHJTFSA-N |
| XLogP | 5.21 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|