C22H28NO6P — CID 11532118
(3aR,4S,6S,6aR)-4-bis(phenylmethoxy)phosphoryl-5-hydroxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 11532118) has the molecular formula C22H28NO6P and a molecular weight of 433.44 g/mol. Its IUPAC name is (3aR,4S,6S,6aR)-4-bis(phenylmethoxy)phosphoryl-5-hydroxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aR,4S,6S,6aR)-4-bis(phenylmethoxy)phosphoryl-5-hydroxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 11532118 |
| Molecular Formula | C22H28NO6P |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (3aR,4S,6S,6aR)-4-bis(phenylmethoxy)phosphoryl-5-hydroxy-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](P(=O)(OCc2ccccc2)OCc2ccccc2)N1O |
| InChI | InChI=1S/C22H28NO6P/c1-16-19-20(29-22(2,3)28-19)21(23(16)24)30(25,26-14-17-10-6-4-7-11-17)27-15-18-12-8-5-9-13-18/h4-13,16,19-21,24H,14-15H2,1-3H3/t16-,19+,20+,21-/m0/s1 |
| InChIKey | HJVPTZQCBFMEEH-ZXNZYJFHSA-N |
| XLogP | 4.55 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|