C22H34NO7P — CID 102374133
benzyl (3aS,4S,6S,6aR)-4-(2-diethoxyphosphorylethyl)-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 102374133) has the molecular formula C22H34NO7P and a molecular weight of 455.49 g/mol. Its IUPAC name is benzyl (3aS,4S,6S,6aR)-4-(2-diethoxyphosphorylethyl)-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | benzyl (3aS,4S,6S,6aR)-4-(2-diethoxyphosphorylethyl)-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 102374133 |
| Molecular Formula | C22H34NO7P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | benzyl (3aS,4S,6S,6aR)-4-(2-diethoxyphosphorylethyl)-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCOP(=O)(CC[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@H](C)N1C(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C22H34NO7P/c1-6-27-31(25,28-7-2)14-13-18-20-19(29-22(4,5)30-20)16(3)23(18)21(24)26-15-17-11-9-8-10-12-17/h8-12,16,18-20H,6-7,13-15H2,1-5H3/t16-,18-,19+,20-/m0/s1 |
| InChIKey | WBWAEQVKXAUAGA-FFGOWVMKSA-N |
| XLogP | 4.57 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|