C29H40NO9P — CID 134877576
N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-N-[(1S)-1-bis(phenylmethoxy)phosphorylethyl]hydroxylamine (PubChem CID 134877576) has the molecular formula C29H40NO9P and a molecular weight of 577.61 g/mol. Its IUPAC name is N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-N-[(1S)-1-bis(phenylmethoxy)phosphorylethyl]hydroxylamine.
| Compound Name | N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-N-[(1S)-1-bis(phenylmethoxy)phosphorylethyl]hydroxylamine |
|---|---|
| PubChem CID | 134877576 |
| Molecular Formula | C29H40NO9P |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-N-[(1S)-1-bis(phenylmethoxy)phosphorylethyl]hydroxylamine |
| SMILES | C[C@@H](N(O)[C@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@]2(C)OC(C)(C)O[C@H]12)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H40NO9P/c1-20(40(32,34-17-21-13-9-7-10-14-21)35-18-22-15-11-8-12-16-22)30(31)26-25-29(6,39-28(4,5)38-25)24(36-26)23-19-33-27(2,3)37-23/h7-16,20,23-26,31H,17-19H2,1-6H3/t20-,23+,24+,25+,26-,29-/m0/s1 |
| InChIKey | HBLQEDZRYUHULH-FYAAUTSISA-N |
| XLogP | 5.44 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|