C23H32NO6P — CID 23266109
benzyl 3-(benzylamino)propyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl phosphate (PubChem CID 23266109) has the molecular formula C23H32NO6P and a molecular weight of 449.48 g/mol. Its IUPAC name is benzyl 3-(benzylamino)propyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl phosphate.
| Compound Name | benzyl 3-(benzylamino)propyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl phosphate |
|---|---|
| PubChem CID | 23266109 |
| Molecular Formula | C23H32NO6P |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | benzyl 3-(benzylamino)propyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl phosphate |
| SMILES | CC1(C)OCC(COP(=O)(OCCCNCc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H32NO6P/c1-23(2)26-18-22(30-23)19-29-31(25,28-17-21-12-7-4-8-13-21)27-15-9-14-24-16-20-10-5-3-6-11-20/h3-8,10-13,22,24H,9,14-19H2,1-2H3 |
| InChIKey | FLVRVPIAFUUHLM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|