C19H32NO6P — CID 23271914
benzyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(propan-2-ylamino)propyl phosphate (PubChem CID 23271914) has the molecular formula C19H32NO6P and a molecular weight of 401.44 g/mol. Its IUPAC name is benzyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(propan-2-ylamino)propyl phosphate.
| Compound Name | benzyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(propan-2-ylamino)propyl phosphate |
|---|---|
| PubChem CID | 23271914 |
| Molecular Formula | C19H32NO6P |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | benzyl (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(propan-2-ylamino)propyl phosphate |
| SMILES | CC(C)NCCCOP(=O)(OCc1ccccc1)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C19H32NO6P/c1-16(2)20-11-8-12-23-27(21,24-13-17-9-6-5-7-10-17)25-15-18-14-22-19(3,4)26-18/h5-7,9-10,16,18,20H,8,11-15H2,1-4H3 |
| InChIKey | GSODHUGSSBHESO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|