C19H32NO6P — CID 71395722
benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] hydrogen phosphate (PubChem CID 71395722) has the molecular formula C19H32NO6P and a molecular weight of 401.44 g/mol. Its IUPAC name is benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] hydrogen phosphate.
| Compound Name | benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] hydrogen phosphate |
|---|---|
| PubChem CID | 71395722 |
| Molecular Formula | C19H32NO6P |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] hydrogen phosphate |
| SMILES | CC(C)NC(CCOP(=O)(O)OCc1ccccc1)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C19H32NO6P/c1-15(2)20-17(12-18-14-23-19(3,4)26-18)10-11-24-27(21,22)25-13-16-8-6-5-7-9-16/h5-9,15,17-18,20H,10-14H2,1-4H3,(H,21,22) |
| InChIKey | YKPXYPHYVLQURQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|