C35H33ClO9 — CID 101103340
[(2R,3R,4S,5R,6R)-6-[(4-chlorophenoxy)carbonyloxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 101103340) has the molecular formula C35H33ClO9 and a molecular weight of 633.09 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(4-chlorophenoxy)carbonyloxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(4-chlorophenoxy)carbonyloxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101103340 |
| Molecular Formula | C35H33ClO9 |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(4-chlorophenoxy)carbonyloxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | CO[C@@H]1O[C@H](COC(=O)Oc2ccc(Cl)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H33ClO9/c1-39-34-32(45-33(37)26-15-9-4-10-16-26)31(41-22-25-13-7-3-8-14-25)30(40-21-24-11-5-2-6-12-24)29(44-34)23-42-35(38)43-28-19-17-27(36)18-20-28/h2-20,29-32,34H,21-23H2,1H3/t29-,30-,31+,32-,34-/m1/s1 |
| InChIKey | KTSHZAJFQDMCPA-XDURGXAYSA-N |
| XLogP | 6.62 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|