C19H28O6S — CID 101103917
[(2R)-5-(benzenesulfonyl)-6-hydroxy-6-propyloxan-2-yl]methyl butanoate (PubChem CID 101103917) has the molecular formula C19H28O6S and a molecular weight of 384.49 g/mol. Its IUPAC name is [(2R)-5-(benzenesulfonyl)-6-hydroxy-6-propyloxan-2-yl]methyl butanoate.
| Compound Name | [(2R)-5-(benzenesulfonyl)-6-hydroxy-6-propyloxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 101103917 |
| Molecular Formula | C19H28O6S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(2R)-5-(benzenesulfonyl)-6-hydroxy-6-propyloxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1CCC(S(=O)(=O)c2ccccc2)C(O)(CCC)O1 |
| InChI | InChI=1S/C19H28O6S/c1-3-8-18(20)24-14-15-11-12-17(19(21,25-15)13-4-2)26(22,23)16-9-6-5-7-10-16/h5-7,9-10,15,17,21H,3-4,8,11-14H2,1-2H3/t15-,17?,19?/m1/s1 |
| InChIKey | FJIXZHFGFYPXQJ-LSJNQWAISA-N |
| XLogP | 2.84 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |