C14H27N — CID 101105438
(5R,8aR)-8a-deuterio-5-hexyl-2,3,5,6,7,8-hexahydro-1H-indolizine (PubChem CID 101105438) has the molecular formula C14H27N and a molecular weight of 210.38 g/mol. Its IUPAC name is (5R,8aR)-8a-deuterio-5-hexyl-2,3,5,6,7,8-hexahydro-1H-indolizine.
| Compound Name | (5R,8aR)-8a-deuterio-5-hexyl-2,3,5,6,7,8-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 101105438 |
| Molecular Formula | C14H27N |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | (5R,8aR)-8a-deuterio-5-hexyl-2,3,5,6,7,8-hexahydro-1H-indolizine |
| SMILES | [2H][C@]12CCC[C@@H](CCCCCC)N1CCC2 |
| InChI | InChI=1S/C14H27N/c1-2-3-4-5-8-13-9-6-10-14-11-7-12-15(13)14/h13-14H,2-12H2,1H3/t13-,14-/m1/s1/i14D |
| InChIKey | AXAQOPLJIFRMGI-TZRALSCDSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|