C16H21NO2 — CID 101108152
(3E)-3-(cyclopropylmethylidene)-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide (PubChem CID 101108152) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (3E)-3-(cyclopropylmethylidene)-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide.
| Compound Name | (3E)-3-(cyclopropylmethylidene)-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 101108152 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3E)-3-(cyclopropylmethylidene)-2-oxo-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CC/C(=C\C2CC2)C1=O |
| InChI | InChI=1S/C16H21NO2/c1-3-9-17(10-4-2)16(19)14-8-7-13(15(14)18)11-12-5-6-12/h3-4,11-12,14H,1-2,5-10H2/b13-11+ |
| InChIKey | NPPDPJHZSSILRC-ACCUITESSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|