C15H20N2O8S — CID 10110818
2-[carboxy-[[(1S)-1-carboxy-4-methylsulfanylbutyl]carbamoyloxy]methyl]-N-hydroxybenzeneamine oxide (PubChem CID 10110818) has the molecular formula C15H20N2O8S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[carboxy-[[(1S)-1-carboxy-4-methylsulfanylbutyl]carbamoyloxy]methyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[carboxy-[[(1S)-1-carboxy-4-methylsulfanylbutyl]carbamoyloxy]methyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 10110818 |
| Molecular Formula | C15H20N2O8S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-[carboxy-[[(1S)-1-carboxy-4-methylsulfanylbutyl]carbamoyloxy]methyl]-N-hydroxybenzeneamine oxide |
| SMILES | CSCCC[C@H](NC(=O)OC(C(=O)O)c1ccccc1[NH+]([O-])O)C(=O)O |
| InChI | InChI=1S/C15H20N2O8S/c1-26-8-4-6-10(13(18)19)16-15(22)25-12(14(20)21)9-5-2-3-7-11(9)17(23)24/h2-3,5,7,10,12,17,23H,4,6,8H2,1H3,(H,16,22)(H,18,19)(H,20,21)/t10-,12?/m0/s1 |
| InChIKey | PULOKIPVGNOFGN-NUHJPDEHSA-N |
| XLogP | 0.54 |
| TPSA | 160.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|