C56H90N4O5 — CID 101116033
3-(3,4-dioctoxyphenyl)-1-[2-[2-[3-(3,4-dioctoxyphenyl)-5-methylpyrazol-1-yl]ethoxy]ethyl]-5-methylpyrazole (PubChem CID 101116033) has the molecular formula C56H90N4O5 and a molecular weight of 899.36 g/mol. Its IUPAC name is 3-(3,4-dioctoxyphenyl)-1-[2-[2-[3-(3,4-dioctoxyphenyl)-5-methylpyrazol-1-yl]ethoxy]ethyl]-5-methylpyrazole.
| Compound Name | 3-(3,4-dioctoxyphenyl)-1-[2-[2-[3-(3,4-dioctoxyphenyl)-5-methylpyrazol-1-yl]ethoxy]ethyl]-5-methylpyrazole |
|---|---|
| PubChem CID | 101116033 |
| Molecular Formula | C56H90N4O5 |
| Molecular Weight | 899.36 g/mol |
| Exact Mass | 898.69 |
| IUPAC Name | 3-(3,4-dioctoxyphenyl)-1-[2-[2-[3-(3,4-dioctoxyphenyl)-5-methylpyrazol-1-yl]ethoxy]ethyl]-5-methylpyrazole |
| SMILES | CCCCCCCCOc1ccc(-c2cc(C)n(CCOCCn3nc(-c4ccc(OCCCCCCCC)c(OCCCCCCCC)c4)cc3C)n2)cc1OCCCCCCCC |
| InChI | InChI=1S/C56H90N4O5/c1-7-11-15-19-23-27-37-62-53-33-31-49(45-55(53)64-39-29-25-21-17-13-9-3)51-43-47(5)59(57-51)35-41-61-42-36-60-48(6)44-52(58-60)50-32-34-54(63-38-28-24-20-16-12-8-2)56(46-50)65-40-30-26-22-18-14-10-4/h31-34,43-46H,7-30,35-42H2,1-6H3 |
| InChIKey | PDHUBBIOMOSLMS-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 81.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.36 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|