C21H30N2O2 — CID 57252907
2-[4-hexoxy-3-(2-methylbutoxy)phenyl]pyrazine (PubChem CID 57252907) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-[4-hexoxy-3-(2-methylbutoxy)phenyl]pyrazine.
| Compound Name | 2-[4-hexoxy-3-(2-methylbutoxy)phenyl]pyrazine |
|---|---|
| PubChem CID | 57252907 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-[4-hexoxy-3-(2-methylbutoxy)phenyl]pyrazine |
| SMILES | CCCCCCOc1ccc(-c2cnccn2)cc1OCC(C)CC |
| InChI | InChI=1S/C21H30N2O2/c1-4-6-7-8-13-24-20-10-9-18(19-15-22-11-12-23-19)14-21(20)25-16-17(3)5-2/h9-12,14-15,17H,4-8,13,16H2,1-3H3 |
| InChIKey | GMRVEKBJBZKQJN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|