C57H70N4O6 — CID 160647311
[4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-heptylbenzoate;[4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-hexylbenzoate (PubChem CID 160647311) has the molecular formula C57H70N4O6 and a molecular weight of 907.21 g/mol. Its IUPAC name is [4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-heptylbenzoate;[4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-hexylbenzoate.
| Compound Name | [4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-heptylbenzoate;[4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-hexylbenzoate |
|---|---|
| PubChem CID | 160647311 |
| Molecular Formula | C57H70N4O6 |
| Molecular Weight | 907.21 g/mol |
| Exact Mass | 906.53 |
| IUPAC Name | [4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-heptylbenzoate;[4-(2-methylbutoxy)-2-pyrazin-2-ylphenyl] 4-hexylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccc(OCC(C)CC)cc2-c2cnccn2)cc1.CCCCCCc1ccc(C(=O)Oc2ccc(OCC(C)CC)cc2-c2cnccn2)cc1 |
| InChI | InChI=1S/C29H36N2O3.C28H34N2O3/c1-4-6-7-8-9-10-23-11-13-24(14-12-23)29(32)34-28-16-15-25(33-21-22(3)5-2)19-26(28)27-20-30-17-18-31-27;1-4-6-7-8-9-22-10-12-23(13-11-22)28(31)33-27-15-14-24(32-20-21(3)5-2)18-25(27)26-19-29-16-17-30-26/h11-20,22H,4-10,21H2,1-3H3;10-19,21H,4-9,20H2,1-3H3 |
| InChIKey | RJYLNAJVLHLUFX-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 122.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.21 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|