C22H29N3O4 — CID 139983727
6-[2-[(2S)-2-methylbutoxy]-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid (PubChem CID 139983727) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 6-[2-[(2S)-2-methylbutoxy]-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid.
| Compound Name | 6-[2-[(2S)-2-methylbutoxy]-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 139983727 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 6-[2-[(2S)-2-methylbutoxy]-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid |
| SMILES | CC[C@H](C)COc1cc(/N=N/c2ccncc2)ccc1OCCCCCC(=O)O |
| InChI | InChI=1S/C22H29N3O4/c1-3-17(2)16-29-21-15-19(25-24-18-10-12-23-13-11-18)8-9-20(21)28-14-6-4-5-7-22(26)27/h8-13,15,17H,3-7,14,16H2,1-2H3,(H,26,27)/b25-24+/t17-/m0/s1 |
| InChIKey | UVSLWABSXROABI-QDVZYSMTSA-N |
| XLogP | 5.95 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|