C23H15F5N2O3 — CID 101116405
N-[1-[4-(4-cyanophenyl)phenoxy]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-N-hydroxyformamide (PubChem CID 101116405) has the molecular formula C23H15F5N2O3 and a molecular weight of 462.37 g/mol. Its IUPAC name is N-[1-[4-(4-cyanophenyl)phenoxy]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[1-[4-(4-cyanophenyl)phenoxy]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 101116405 |
| Molecular Formula | C23H15F5N2O3 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-[1-[4-(4-cyanophenyl)phenoxy]-3-(2,3,4,5,6-pentafluorophenyl)propan-2-yl]-N-hydroxyformamide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(Cc3c(F)c(F)c(F)c(F)c3F)N(O)C=O)cc2)cc1 |
| InChI | InChI=1S/C23H15F5N2O3/c24-19-18(20(25)22(27)23(28)21(19)26)9-16(30(32)12-31)11-33-17-7-5-15(6-8-17)14-3-1-13(10-29)2-4-14/h1-8,12,16,32H,9,11H2 |
| InChIKey | KZOZUEJKRBPNOQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|