C22H25N3O6 — CID 10137341
N-[(2S)-1-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]-N-hydroxyformamide (PubChem CID 10137341) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[(2S)-1-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-1-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10137341 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[(2S)-1-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]-N-hydroxyformamide |
| SMILES | COc1ccc(-c2ccc(OC[C@H](CN3C(=O)NC(C)(C)C3=O)N(O)C=O)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O6/c1-22(2)20(27)24(21(28)23-22)12-17(25(29)14-26)13-31-19-10-6-16(7-11-19)15-4-8-18(30-3)9-5-15/h4-11,14,17,29H,12-13H2,1-3H3,(H,23,28)/t17-/m0/s1 |
| InChIKey | OSSMSHMXGNMGGX-KRWDZBQOSA-N |
| XLogP | 2.29 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|