C22H22N4O5S — CID 11048709
N-[1-[4-(4-cyanophenoxy)phenyl]sulfanyl-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]-N-hydroxyformamide (PubChem CID 11048709) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[1-[4-(4-cyanophenoxy)phenyl]sulfanyl-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[1-[4-(4-cyanophenoxy)phenyl]sulfanyl-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11048709 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[1-[4-(4-cyanophenoxy)phenyl]sulfanyl-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]-N-hydroxyformamide |
| SMILES | CC1(C)NC(=O)N(CC(CSc2ccc(Oc3ccc(C#N)cc3)cc2)N(O)C=O)C1=O |
| InChI | InChI=1S/C22H22N4O5S/c1-22(2)20(28)25(21(29)24-22)12-16(26(30)14-27)13-32-19-9-7-18(8-10-19)31-17-5-3-15(11-23)4-6-17/h3-10,14,16,30H,12-13H2,1-2H3,(H,24,29) |
| InChIKey | MZYYMWKXXWULON-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|