C21H22F3N3O5S — CID 11812900
3-[2-(hydroxyamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfanylpropyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 11812900) has the molecular formula C21H22F3N3O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is 3-[2-(hydroxyamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfanylpropyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(hydroxyamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfanylpropyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11812900 |
| Molecular Formula | C21H22F3N3O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-[2-(hydroxyamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfanylpropyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(CSc2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)NO)C1=O |
| InChI | InChI=1S/C21H22F3N3O5S/c1-20(2)18(28)27(19(29)25-20)11-13(26-30)12-33-17-9-7-15(8-10-17)31-14-3-5-16(6-4-14)32-21(22,23)24/h3-10,13,26,30H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | PTWDWSILBBDODC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|