C21H22N4O4S — CID 10982823
4-[4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-(hydroxyamino)propyl]sulfanylphenoxy]benzonitrile (PubChem CID 10982823) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-[4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-(hydroxyamino)propyl]sulfanylphenoxy]benzonitrile.
| Compound Name | 4-[4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-(hydroxyamino)propyl]sulfanylphenoxy]benzonitrile |
|---|---|
| PubChem CID | 10982823 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-[4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-(hydroxyamino)propyl]sulfanylphenoxy]benzonitrile |
| SMILES | CC1(C)NC(=O)N(CC(CSc2ccc(Oc3ccc(C#N)cc3)cc2)NO)C1=O |
| InChI | InChI=1S/C21H22N4O4S/c1-21(2)19(26)25(20(27)23-21)12-15(24-28)13-30-18-9-7-17(8-10-18)29-16-5-3-14(11-22)4-6-16/h3-10,15,24,28H,12-13H2,1-2H3,(H,23,27) |
| InChIKey | AOWILDXIZIFHIV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|