C21H19F3N2O4S — CID 11015854
5,5-dimethyl-3-[2-oxo-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylpropyl]imidazolidine-2,4-dione (PubChem CID 11015854) has the molecular formula C21H19F3N2O4S and a molecular weight of 452.45 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-oxo-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylpropyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-oxo-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylpropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11015854 |
| Molecular Formula | C21H19F3N2O4S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5,5-dimethyl-3-[2-oxo-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]sulfanylpropyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(=O)CSc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)C1=O |
| InChI | InChI=1S/C21H19F3N2O4S/c1-20(2)18(28)26(19(29)25-20)11-15(27)12-31-17-9-5-14(6-10-17)13-3-7-16(8-4-13)30-21(22,23)24/h3-10H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | FZLRCINCEMNSND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|