C24H37NOSi — CID 101116648
(3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxydeca-3,5,7,9-tetraenenitrile (PubChem CID 101116648) has the molecular formula C24H37NOSi and a molecular weight of 383.65 g/mol. Its IUPAC name is (3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxydeca-3,5,7,9-tetraenenitrile.
| Compound Name | (3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxydeca-3,5,7,9-tetraenenitrile |
|---|---|
| PubChem CID | 101116648 |
| Molecular Formula | C24H37NOSi |
| Molecular Weight | 383.65 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)-2-trimethylsilyloxydeca-3,5,7,9-tetraenenitrile |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(C#N)O[Si](C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H37NOSi/c1-19(14-15-23-21(3)13-10-16-24(23,4)5)11-9-12-20(2)17-22(18-25)26-27(6,7)8/h9,11-12,14-15,17,22H,10,13,16H2,1-8H3/b12-9+,15-14+,19-11+,20-17+ |
| InChIKey | PNOWACWORYUQQM-XUJYDZMUSA-N |
| XLogP | 7.26 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|