C22H37NOSi — CID 134901613
2-[(5R)-5-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]acetonitrile (PubChem CID 134901613) has the molecular formula C22H37NOSi and a molecular weight of 359.63 g/mol. Its IUPAC name is 2-[(5R)-5-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]acetonitrile.
| Compound Name | 2-[(5R)-5-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]acetonitrile |
|---|---|
| PubChem CID | 134901613 |
| Molecular Formula | C22H37NOSi |
| Molecular Weight | 359.63 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 2-[(5R)-5-[(1R,2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]acetonitrile |
| SMILES | C=C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC(C)=C(CC#N)C1(C)C |
| InChI | InChI=1S/C22H37NOSi/c1-10-11-12-20(24-25(8,9)21(3,4)5)19-14-13-17(2)18(15-16-23)22(19,6)7/h10-12,19-20H,1,13-15H2,2-9H3/b12-11+/t19-,20+/m0/s1 |
| InChIKey | BFATUKTVHLPQLZ-ONNIGLJISA-N |
| XLogP | 6.79 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|