C27H43NOSi — CID 73195997
2-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraenenitrile (PubChem CID 73195997) has the molecular formula C27H43NOSi and a molecular weight of 425.73 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraenenitrile.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraenenitrile |
|---|---|
| PubChem CID | 73195997 |
| Molecular Formula | C27H43NOSi |
| Molecular Weight | 425.73 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraenenitrile |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H43NOSi/c1-21(16-17-25-23(3)15-12-18-27(25,7)8)13-11-14-22(2)19-24(20-28)29-30(9,10)26(4,5)6/h11,13-14,16-17,19,24H,12,15,18H2,1-10H3 |
| InChIKey | LJKFKXGULCBZKA-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.73 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|